![(1R,2R,4S)-rel-Bicyclo[2.2.1]heptan-2-amine (CAS: 7242-92-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0698896.png "(1R,2R,4S)-rel-Bicyclo[2.2.1]heptan-2-amine chemical structure")
(1R,2R,4S)-rel-Bicyclo[2.2.1]heptan-2-amine
Catalog No: FT-0698896
CAS No: 7242-92-4
- Chemical Name: (1R,2R,4S)-rel-Bicyclo[2.2.1]heptan-2-amine
- Molecular Formula: C7H13N
- Molecular Weight: 111.18
- InChI Key: JEPPYVOSGKWVSJ-RRKCRQDMSA-N
- InChI: InChI=1S/C7H13N/c8-7-4-5-1-2-6(7)3-5/h5-7H,1-4,8H2/t5-,6+,7+/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS02, GHS07 |
|---|---|
| CAS: | 7242-92-4 |
| Flash_Point: | 35.0±0.0 °C |
| Product_Name: | 2-norbornanamine |
| Bolling_Point: | 160.0±8.0 °C at 760 mmHg |
| FW: | 111.185 |
| Melting_Point: | N/A |
| MF: | C7H13N |
| Density: | 1.0±0.1 g/cm3 |
| Refractive_Index: | 1.513 |
|---|---|
| Vapor_Pressure: | 2.4±0.3 mmHg at 25°C |
| MF: | C7H13N |
| Flash_Point: | 35.0±0.0 °C |
| LogP: | 1.25 |
| FW: | 111.185 |
| Density: | 1.0±0.1 g/cm3 |
| PSA: | 26.02000 |
| Bolling_Point: | 160.0±8.0 °C at 760 mmHg |
| Exact_Mass: | 111.104797 |
| Symbol: | GHS02, GHS07 |
|---|---|
| RIDADR: | UN 2733 3/PG 3 |
| HS_Code: | 2921300090 |
| Packing_Group: | III |
| Hazard_Class: | 3.2 |
| Risk_Statements(EU): | 10-36/37/38 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard_Codes: | Xi |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H226-H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)